C28H21ClN6O — CID 90236305
2-[2-[[6-amino-5-(2-phenylethynyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-3-phenylquinazolin-4-one (PubChem CID 90236305) has the molecular formula C28H21ClN6O and a molecular weight of 492.97 g/mol. Its IUPAC name is 2-[2-[[6-amino-5-(2-phenylethynyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-3-phenylquinazolin-4-one.
| Compound Name | 2-[2-[[6-amino-5-(2-phenylethynyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 90236305 |
| Molecular Formula | C28H21ClN6O |
| Molecular Weight | 492.97 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-[2-[[6-amino-5-(2-phenylethynyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-3-phenylquinazolin-4-one |
| SMILES | Nc1ncnc(NCCc2nc3cccc(Cl)c3c(=O)n2-c2ccccc2)c1C#Cc1ccccc1 |
| InChI | InChI=1S/C28H21ClN6O/c29-22-12-7-13-23-25(22)28(36)35(20-10-5-2-6-11-20)24(34-23)16-17-31-27-21(26(30)32-18-33-27)15-14-19-8-3-1-4-9-19/h1-13,18H,16-17H2,(H3,30,31,32,33) |
| InChIKey | XQOIJVHGBYBQOX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.97 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|