C30H22N6O — CID 90253701
2-[1-[[6-amino-5-(2-phenylethynyl)pyrimidin-4-yl]amino]ethyl]-5-ethynyl-3-phenylquinazolin-4-one (PubChem CID 90253701) has the molecular formula C30H22N6O and a molecular weight of 482.55 g/mol. Its IUPAC name is 2-[1-[[6-amino-5-(2-phenylethynyl)pyrimidin-4-yl]amino]ethyl]-5-ethynyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[1-[[6-amino-5-(2-phenylethynyl)pyrimidin-4-yl]amino]ethyl]-5-ethynyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 90253701 |
| Molecular Formula | C30H22N6O |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 2-[1-[[6-amino-5-(2-phenylethynyl)pyrimidin-4-yl]amino]ethyl]-5-ethynyl-3-phenylquinazolin-4-one |
| SMILES | C#Cc1cccc2nc(C(C)Nc3ncnc(N)c3C#Cc3ccccc3)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C30H22N6O/c1-3-22-13-10-16-25-26(22)30(37)36(23-14-8-5-9-15-23)29(35-25)20(2)34-28-24(27(31)32-19-33-28)18-17-21-11-6-4-7-12-21/h1,4-16,19-20H,2H3,(H3,31,32,33,34) |
| InChIKey | YSVNRCOOHBQYDI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|