C29H44NO6PS — CID 67465637
3-(3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)pentan-3-ylphosphonic acid (PubChem CID 67465637) has the molecular formula C29H44NO6PS and a molecular weight of 565.71 g/mol. Its IUPAC name is 3-(3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)pentan-3-ylphosphonic acid.
| Compound Name | 3-(3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 67465637 |
| Molecular Formula | C29H44NO6PS |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 3-(3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)pentan-3-ylphosphonic acid |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2cc(C(CC)(CC)P(=O)(O)O)c(OC)cc2C(c2ccccc2)N1 |
| InChI | InChI=1S/C29H44NO6PS/c1-6-10-17-28(18-11-7-2)21-38(34,35)26-20-24(29(8-3,9-4)37(31,32)33)25(36-5)19-23(26)27(30-28)22-15-13-12-14-16-22/h12-16,19-20,27,30H,6-11,17-18,21H2,1-5H3,(H2,31,32,33) |
| InChIKey | QNPVYSBXZXAKAC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|