C11H19FO6 — CID 67466196
1-[(3S,4S,5S,6R)-2-fluoro-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 67466196) has the molecular formula C11H19FO6 and a molecular weight of 266.26 g/mol. Its IUPAC name is 1-[(3S,4S,5S,6R)-2-fluoro-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(3S,4S,5S,6R)-2-fluoro-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 67466196 |
| Molecular Formula | C11H19FO6 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-[(3S,4S,5S,6R)-2-fluoro-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)C1(F)O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H19FO6/c1-10(2,3)9(17)11(12)8(16)7(15)6(14)5(4-13)18-11/h5-8,13-16H,4H2,1-3H3/t5-,6-,7+,8+,11?/m1/s1 |
| InChIKey | ICCRYIQNXXBXMC-IIOPNJDFSA-N |
| XLogP | -1.26 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |