C8H4FNO2S — CID 67467360
6-fluoro-1,3-benzothiazole-4-carboxylic acid (PubChem CID 67467360) has the molecular formula C8H4FNO2S and a molecular weight of 197.19 g/mol. Its IUPAC name is 6-fluoro-1,3-benzothiazole-4-carboxylic acid.
| Compound Name | 6-fluoro-1,3-benzothiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67467360 |
| Molecular Formula | C8H4FNO2S |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 6-fluoro-1,3-benzothiazole-4-carboxylic acid |
| SMILES | O=C(O)c1cc(F)cc2scnc12 |
| InChI | InChI=1S/C8H4FNO2S/c9-4-1-5(8(11)12)7-6(2-4)13-3-10-7/h1-3H,(H,11,12) |
| InChIKey | GNGJOTROCBBLJP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |