C17H18FN5O2 — CID 67467779
3-[(1R)-1-(5-fluoro-2-methoxyphenyl)ethoxy]-5-(3-methyltriazol-4-yl)pyridin-2-amine (PubChem CID 67467779) has the molecular formula C17H18FN5O2 and a molecular weight of 343.36 g/mol. Its IUPAC name is 3-[(1R)-1-(5-fluoro-2-methoxyphenyl)ethoxy]-5-(3-methyltriazol-4-yl)pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(5-fluoro-2-methoxyphenyl)ethoxy]-5-(3-methyltriazol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 67467779 |
| Molecular Formula | C17H18FN5O2 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-[(1R)-1-(5-fluoro-2-methoxyphenyl)ethoxy]-5-(3-methyltriazol-4-yl)pyridin-2-amine |
| SMILES | COc1ccc(F)cc1[C@@H](C)Oc1cc(-c2cnnn2C)cnc1N |
| InChI | InChI=1S/C17H18FN5O2/c1-10(13-7-12(18)4-5-15(13)24-3)25-16-6-11(8-20-17(16)19)14-9-21-22-23(14)2/h4-10H,1-3H3,(H2,19,20)/t10-/m1/s1 |
| InChIKey | GXUFIECYEKHMLD-SNVBAGLBSA-N |
| XLogP | 2.75 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |