C8H8F3N3O4 — CID 67468129
formic acid;6-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 67468129) has the molecular formula C8H8F3N3O4 and a molecular weight of 267.16 g/mol. Its IUPAC name is formic acid;6-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | formic acid;6-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 67468129 |
| Molecular Formula | C8H8F3N3O4 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | formic acid;6-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cncc(OCC(F)(F)F)n1.O=CO |
| InChI | InChI=1S/C7H6F3N3O2.CH2O2/c8-7(9,10)3-15-5-2-12-1-4(13-5)6(11)14;2-1-3/h1-2H,3H2,(H2,11,14);1H,(H,2,3) |
| InChIKey | RGBJPLBVIYQNSM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|