C8H9F2N3O2 — CID 90318436
5-(2,2-difluoroethoxy)-3-methylpyrazine-2-carboxamide (PubChem CID 90318436) has the molecular formula C8H9F2N3O2 and a molecular weight of 217.18 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-3-methylpyrazine-2-carboxamide.
| Compound Name | 5-(2,2-difluoroethoxy)-3-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90318436 |
| Molecular Formula | C8H9F2N3O2 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-3-methylpyrazine-2-carboxamide |
| SMILES | Cc1nc(OCC(F)F)cnc1C(N)=O |
| InChI | InChI=1S/C8H9F2N3O2/c1-4-7(8(11)14)12-2-6(13-4)15-3-5(9)10/h2,5H,3H2,1H3,(H2,11,14) |
| InChIKey | CUZLZKSBROWRPQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |