C16H24N2OS — CID 67468257
2-cyclohexyl-1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 67468257) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-cyclohexyl-1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 2-cyclohexyl-1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 67468257 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-cyclohexyl-1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | O=C(CC1CCCCC1)c1csc(C2CCNCC2)n1 |
| InChI | InChI=1S/C16H24N2OS/c19-15(10-12-4-2-1-3-5-12)14-11-20-16(18-14)13-6-8-17-9-7-13/h11-13,17H,1-10H2 |
| InChIKey | FQOBBCQFUNTLHT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |