C21H22N4O4 — CID 67471493
1-(3-methyl-2-pyridinyl)-3-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dioxolane]-10-yl)urea (PubChem CID 67471493) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 1-(3-methyl-2-pyridinyl)-3-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dioxolane]-10-yl)urea.
| Compound Name | 1-(3-methyl-2-pyridinyl)-3-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dioxolane]-10-yl)urea |
|---|---|
| PubChem CID | 67471493 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-(3-methyl-2-pyridinyl)-3-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dioxolane]-10-yl)urea |
| SMILES | Cc1cccnc1NC(=O)Nc1cccc2c1C1CC3(CCN1C2=O)OCCO3 |
| InChI | InChI=1S/C21H22N4O4/c1-13-4-3-8-22-18(13)24-20(27)23-15-6-2-5-14-17(15)16-12-21(28-10-11-29-21)7-9-25(16)19(14)26/h2-6,8,16H,7,9-12H2,1H3,(H2,22,23,24,27) |
| InChIKey | SGLFNEQEJCBMII-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |