C19H19N5O4 — CID 67134967
1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dioxolane]-10-yl)-3-pyrazin-2-ylurea (PubChem CID 67134967) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dioxolane]-10-yl)-3-pyrazin-2-ylurea.
| Compound Name | 1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dioxolane]-10-yl)-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 67134967 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dioxolane]-10-yl)-3-pyrazin-2-ylurea |
| SMILES | O=C(Nc1cnccn1)Nc1cccc2c1C1CC3(CCN1C2=O)OCCO3 |
| InChI | InChI=1S/C19H19N5O4/c25-17-12-2-1-3-13(22-18(26)23-15-11-20-5-6-21-15)16(12)14-10-19(4-7-24(14)17)27-8-9-28-19/h1-3,5-6,11,14H,4,7-10H2,(H2,21,22,23,26) |
| InChIKey | DATQQCAISHVBKS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |