C18H24N2O4S — CID 67474575
(2S,4R)-4-(benzenesulfonyl)-1-(cyclohexanecarbonyl)pyrrolidine-2-carboxamide (PubChem CID 67474575) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is (2S,4R)-4-(benzenesulfonyl)-1-(cyclohexanecarbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(benzenesulfonyl)-1-(cyclohexanecarbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67474575 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (2S,4R)-4-(benzenesulfonyl)-1-(cyclohexanecarbonyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H](S(=O)(=O)c2ccccc2)CN1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H24N2O4S/c19-17(21)16-11-15(25(23,24)14-9-5-2-6-10-14)12-20(16)18(22)13-7-3-1-4-8-13/h2,5-6,9-10,13,15-16H,1,3-4,7-8,11-12H2,(H2,19,21)/t15-,16+/m1/s1 |
| InChIKey | HGLNPZLBDBWTET-CVEARBPZSA-N |
| XLogP | 1.50 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |