C28H35N3O — CID 67481860
(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-1-(quinolin-8-ylamino)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 67481860) has the molecular formula C28H35N3O and a molecular weight of 429.61 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-1-(quinolin-8-ylamino)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-1-(quinolin-8-ylamino)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 67481860 |
| Molecular Formula | C28H35N3O |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-1-(quinolin-8-ylamino)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)C=C[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(Nc3cccc4cccnc34)CC[C@@H]12 |
| InChI | InChI=1S/C28H35N3O/c1-27-15-13-21-19(9-12-24-28(21,2)16-14-25(32)31(24)3)20(27)10-11-23(27)30-22-8-4-6-18-7-5-17-29-26(18)22/h4-8,14,16-17,19-21,23-24,30H,9-13,15H2,1-3H3/t19-,20-,21+,23?,24?,27-,28+/m0/s1 |
| InChIKey | BSHLKHOBGLSFQP-TVFXESAHSA-N |
| XLogP | 5.65 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |