C27H34F3N3O2 — CID 67481838
1-[(1S,5aR,9aR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 67481838) has the molecular formula C27H34F3N3O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is 1-[(1S,5aR,9aR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1S,5aR,9aR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 67481838 |
| Molecular Formula | C27H34F3N3O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 1-[(1S,5aR,9aR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CN1C(=O)C=C[C@]2(C)C3CC[C@@]4(C)C(CC[C@@H]4NC(=O)Nc4cccc(C(F)(F)F)c4)C3CC[C@@H]12 |
| InChI | InChI=1S/C27H34F3N3O2/c1-25-13-11-20-18(7-10-22-26(20,2)14-12-23(34)33(22)3)19(25)8-9-21(25)32-24(35)31-17-6-4-5-16(15-17)27(28,29)30/h4-6,12,14-15,18-22H,7-11,13H2,1-3H3,(H2,31,32,35)/t18?,19?,20?,21-,22+,25-,26+/m0/s1 |
| InChIKey | MCAOHZFEZAXHDE-FNMDTEAQSA-N |
| XLogP | 5.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |