C25H32FN3O2 — CID 67874752
1-[(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]-3-(4-fluorophenyl)urea (PubChem CID 67874752) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-[(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 67874752 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 1-[(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]-3-(4-fluorophenyl)urea |
| SMILES | C[C@]12C=CC(=O)NC1CC[C@@H]1[C@H]2CC[C@]2(C)C(NC(=O)Nc3ccc(F)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C25H32FN3O2/c1-24-13-11-19-17(7-9-20-25(19,2)14-12-22(30)28-20)18(24)8-10-21(24)29-23(31)27-16-5-3-15(26)4-6-16/h3-6,12,14,17-21H,7-11,13H2,1-2H3,(H,28,30)(H2,27,29,31)/t17-,18-,19+,20?,21?,24-,25+/m0/s1 |
| InChIKey | DSIFPYHEYWFQNU-CATRVCOHSA-N |
| XLogP | 4.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |