C24H30FNO — CID 70255732
(3aS,3bS,9aR,9bR,11aS)-1-(2-fluorophenyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one (PubChem CID 70255732) has the molecular formula C24H30FNO and a molecular weight of 367.51 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-1-(2-fluorophenyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-1-(2-fluorophenyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 70255732 |
| Molecular Formula | C24H30FNO |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-1-(2-fluorophenyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
| SMILES | C[C@]12C=CC(=O)NC1CC[C@@H]1[C@H]2CC[C@]2(C)C(c3ccccc3F)CC[C@@H]12 |
| InChI | InChI=1S/C24H30FNO/c1-23-13-11-19-15(7-10-21-24(19,2)14-12-22(27)26-21)17(23)8-9-18(23)16-5-3-4-6-20(16)25/h3-6,12,14-15,17-19,21H,7-11,13H2,1-2H3,(H,26,27)/t15-,17-,18?,19+,21?,23-,24+/m0/s1 |
| InChIKey | SZBKJAZPKIWSAS-JOSXYCNHSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |