C28H35ClF3N3O2 — CID 163698022
1-[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-5a,6,9a,11a-tetramethyl-7-oxo-1,2,3,3a,3b,4,5,9b,10,11-decahydroindeno[5,4-f]quinolin-1-yl]-3-[2-chloro-5-(trifluoromethyl)phenyl]urea (PubChem CID 163698022) has the molecular formula C28H35ClF3N3O2 and a molecular weight of 538.05 g/mol. Its IUPAC name is 1-[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-5a,6,9a,11a-tetramethyl-7-oxo-1,2,3,3a,3b,4,5,9b,10,11-decahydroindeno[5,4-f]quinolin-1-yl]-3-[2-chloro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-5a,6,9a,11a-tetramethyl-7-oxo-1,2,3,3a,3b,4,5,9b,10,11-decahydroindeno[5,4-f]quinolin-1-yl]-3-[2-chloro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 163698022 |
| Molecular Formula | C28H35ClF3N3O2 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 1-[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-5a,6,9a,11a-tetramethyl-7-oxo-1,2,3,3a,3b,4,5,9b,10,11-decahydroindeno[5,4-f]quinolin-1-yl]-3-[2-chloro-5-(trifluoromethyl)phenyl]urea |
| SMILES | CN1C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](NC(=O)Nc5cc(C(F)(F)F)ccc5Cl)CC[C@H]4[C@@H]3CC[C@@]12C |
| InChI | InChI=1S/C28H35ClF3N3O2/c1-25-12-10-19-17(9-14-27(3)26(19,2)13-11-23(36)35(27)4)18(25)6-8-22(25)34-24(37)33-21-15-16(28(30,31)32)5-7-20(21)29/h5,7,11,13,15,17-19,22H,6,8-10,12,14H2,1-4H3,(H2,33,34,37)/t17-,18-,19-,22-,25-,26+,27+/m0/s1 |
| InChIKey | JYODGMLLEKXXJL-XKWGSPIGSA-N |
| XLogP | 6.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |