C23H24ClN5O5S — CID 67482418
2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[(2,5-dioxoimidazolidin-4-ylidene)methyl]pyrazin-2-yl]propanamide (PubChem CID 67482418) has the molecular formula C23H24ClN5O5S and a molecular weight of 518.00 g/mol. Its IUPAC name is 2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[(2,5-dioxoimidazolidin-4-ylidene)methyl]pyrazin-2-yl]propanamide.
| Compound Name | 2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[(2,5-dioxoimidazolidin-4-ylidene)methyl]pyrazin-2-yl]propanamide |
|---|---|
| PubChem CID | 67482418 |
| Molecular Formula | C23H24ClN5O5S |
| Molecular Weight | 518.00 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[(2,5-dioxoimidazolidin-4-ylidene)methyl]pyrazin-2-yl]propanamide |
| SMILES | CS(=O)(=O)c1ccc(C(CC2CCCC2)C(=O)Nc2cnc(C=C3NC(=O)NC3=O)cn2)cc1Cl |
| InChI | InChI=1S/C23H24ClN5O5S/c1-35(33,34)19-7-6-14(9-17(19)24)16(8-13-4-2-3-5-13)21(30)28-20-12-25-15(11-26-20)10-18-22(31)29-23(32)27-18/h6-7,9-13,16H,2-5,8H2,1H3,(H,26,28,30)(H2,27,29,31,32) |
| InChIKey | TZHIHYNCNFQBQB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 147.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.00 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|