C19H23F3O4S — CID 67482990
methyl 3-cycloheptyl-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 67482990) has the molecular formula C19H23F3O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is methyl 3-cycloheptyl-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-cycloheptyl-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67482990 |
| Molecular Formula | C19H23F3O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | methyl 3-cycloheptyl-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | COC(=O)C(=CC1CCCCCC1)c1ccc(S(C)(=O)=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H23F3O4S/c1-26-18(23)15(11-13-7-5-3-4-6-8-13)14-9-10-17(27(2,24)25)16(12-14)19(20,21)22/h9-13H,3-8H2,1-2H3 |
| InChIKey | KIRCOHZYVQOHNX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|