C16H20ClNO5S — CID 87416797
methyl (2E)-2-(3-chloro-4-methylsulfonylphenyl)-2-cyclohexyloxyiminoacetate (PubChem CID 87416797) has the molecular formula C16H20ClNO5S and a molecular weight of 373.86 g/mol. Its IUPAC name is methyl (2E)-2-(3-chloro-4-methylsulfonylphenyl)-2-cyclohexyloxyiminoacetate.
| Compound Name | methyl (2E)-2-(3-chloro-4-methylsulfonylphenyl)-2-cyclohexyloxyiminoacetate |
|---|---|
| PubChem CID | 87416797 |
| Molecular Formula | C16H20ClNO5S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | methyl (2E)-2-(3-chloro-4-methylsulfonylphenyl)-2-cyclohexyloxyiminoacetate |
| SMILES | COC(=O)/C(=N/OC1CCCCC1)c1ccc(S(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C16H20ClNO5S/c1-22-16(19)15(18-23-12-6-4-3-5-7-12)11-8-9-14(13(17)10-11)24(2,20)21/h8-10,12H,3-7H2,1-2H3/b18-15+ |
| InChIKey | JPOQXQHRUYZXPG-OBGWFSINSA-N |
| XLogP | 2.97 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|