C19H23ClN4O4S — CID 59745098
(2E)-2-(3-chloro-4-methylsulfonylphenyl)-2-cyclohexyloxyimino-N-(1-methylpyrazol-3-yl)acetamide (PubChem CID 59745098) has the molecular formula C19H23ClN4O4S and a molecular weight of 438.94 g/mol. Its IUPAC name is (2E)-2-(3-chloro-4-methylsulfonylphenyl)-2-cyclohexyloxyimino-N-(1-methylpyrazol-3-yl)acetamide.
| Compound Name | (2E)-2-(3-chloro-4-methylsulfonylphenyl)-2-cyclohexyloxyimino-N-(1-methylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 59745098 |
| Molecular Formula | C19H23ClN4O4S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | (2E)-2-(3-chloro-4-methylsulfonylphenyl)-2-cyclohexyloxyimino-N-(1-methylpyrazol-3-yl)acetamide |
| SMILES | Cn1ccc(NC(=O)/C(=N/OC2CCCCC2)c2ccc(S(C)(=O)=O)c(Cl)c2)n1 |
| InChI | InChI=1S/C19H23ClN4O4S/c1-24-11-10-17(22-24)21-19(25)18(23-28-14-6-4-3-5-7-14)13-8-9-16(15(20)12-13)29(2,26)27/h8-12,14H,3-7H2,1-2H3,(H,21,22,25)/b23-18+ |
| InChIKey | YTMXHEWZERMVLV-PTGBLXJZSA-N |
| XLogP | 3.17 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|