C38H37NO6 — CID 67482995
3-[[4-[2-(4-cyclohexylphenyl)-4-oxo-4-(4-phenylphenyl)butanoyl]benzoyl]amino]-3-hydroxypropanoic acid (PubChem CID 67482995) has the molecular formula C38H37NO6 and a molecular weight of 603.72 g/mol. Its IUPAC name is 3-[[4-[2-(4-cyclohexylphenyl)-4-oxo-4-(4-phenylphenyl)butanoyl]benzoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 3-[[4-[2-(4-cyclohexylphenyl)-4-oxo-4-(4-phenylphenyl)butanoyl]benzoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 67482995 |
| Molecular Formula | C38H37NO6 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | 3-[[4-[2-(4-cyclohexylphenyl)-4-oxo-4-(4-phenylphenyl)butanoyl]benzoyl]amino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)CC(O)NC(=O)c1ccc(C(=O)C(CC(=O)c2ccc(-c3ccccc3)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C38H37NO6/c40-34(30-17-13-28(14-18-30)26-9-5-2-6-10-26)23-33(29-15-11-27(12-16-29)25-7-3-1-4-8-25)37(44)31-19-21-32(22-20-31)38(45)39-35(41)24-36(42)43/h2,5-6,9-22,25,33,35,41H,1,3-4,7-8,23-24H2,(H,39,45)(H,42,43) |
| InChIKey | GAPPVUJEGHWJBW-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|