C36H31NO5 — CID 142910992
3-[[4-[4-[4-(1-methylcycloprop-2-en-1-yl)phenyl]-1,4-dioxo-1-(4-phenylphenyl)butan-2-yl]benzoyl]amino]propanoic acid (PubChem CID 142910992) has the molecular formula C36H31NO5 and a molecular weight of 557.65 g/mol. Its IUPAC name is 3-[[4-[4-[4-(1-methylcycloprop-2-en-1-yl)phenyl]-1,4-dioxo-1-(4-phenylphenyl)butan-2-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[4-[4-(1-methylcycloprop-2-en-1-yl)phenyl]-1,4-dioxo-1-(4-phenylphenyl)butan-2-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142910992 |
| Molecular Formula | C36H31NO5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 3-[[4-[4-[4-(1-methylcycloprop-2-en-1-yl)phenyl]-1,4-dioxo-1-(4-phenylphenyl)butan-2-yl]benzoyl]amino]propanoic acid |
| SMILES | CC1(c2ccc(C(=O)CC(C(=O)c3ccc(-c4ccccc4)cc3)c3ccc(C(=O)NCCC(=O)O)cc3)cc2)C=C1 |
| InChI | InChI=1S/C36H31NO5/c1-36(20-21-36)30-17-15-27(16-18-30)32(38)23-31(26-9-13-29(14-10-26)35(42)37-22-19-33(39)40)34(41)28-11-7-25(8-12-28)24-5-3-2-4-6-24/h2-18,20-21,31H,19,22-23H2,1H3,(H,37,42)(H,39,40) |
| InChIKey | BHNQPFXFIWNVEH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|