About ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate
ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate (PubChem CID 67483583) has the molecular formula C22H26F3NO3
and a molecular weight of 409.45 g/mol. Its IUPAC name is ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate |
| PubChem CID | 67483583 |
| Molecular Formula | C22H26F3NO3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H26F3NO3/c1-6-29-21(28)18-17(14-7-9-15(10-8-14)22(23,24)25)16(11-27)19(12(2)3)26-20(18)13(4)5/h7-10,12-13,27H,6,11H2,1-5H3 |
| InChIKey | PMRBSXZDTBESCZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate?
The IUPAC name of ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate (CID 67483583) is ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate?
The canonical SMILES for ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate is CCOC(=O)c1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccc(C(F)(F)F)cc1.
What is the InChIKey of ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate?
The InChIKey is PMRBSXZDTBESCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26F3NO3/c1-6-29-21(28)18-17(14-7-9-15(10-8-14)22(23,24)25)16(11-27)19(12(2)3)26-20(18)13(4)5/h7-10,12-13,27H,6,11H2,1-5H3.
What are the key properties of ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate?
ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate has a molecular weight of 409.45 g/mol, XLogP of 5.68, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(hydroxymethyl)-2,6-di(propan-2-yl)-4-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylate is sourced from PubChem (CID 67483583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).