C20H17ClN4O3S — CID 67483712
[3-[2-(4-chlorophenyl)-6-methyl-3-oxo-1H-pyrazolo[4,3-c]pyridin-7-yl]phenyl]methanesulfonamide (PubChem CID 67483712) has the molecular formula C20H17ClN4O3S and a molecular weight of 428.90 g/mol. Its IUPAC name is [3-[2-(4-chlorophenyl)-6-methyl-3-oxo-1H-pyrazolo[4,3-c]pyridin-7-yl]phenyl]methanesulfonamide.
| Compound Name | [3-[2-(4-chlorophenyl)-6-methyl-3-oxo-1H-pyrazolo[4,3-c]pyridin-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67483712 |
| Molecular Formula | C20H17ClN4O3S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | [3-[2-(4-chlorophenyl)-6-methyl-3-oxo-1H-pyrazolo[4,3-c]pyridin-7-yl]phenyl]methanesulfonamide |
| SMILES | Cc1ncc2c(=O)n(-c3ccc(Cl)cc3)[nH]c2c1-c1cccc(CS(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H17ClN4O3S/c1-12-18(14-4-2-3-13(9-14)11-29(22,27)28)19-17(10-23-12)20(26)25(24-19)16-7-5-15(21)6-8-16/h2-10,24H,11H2,1H3,(H2,22,27,28) |
| InChIKey | PUUYCCSHVKRPDV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|