C22H21N3O2 — CID 67483789
1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methanehydrazonoylnaphthalen-1-yl)oxyethanone (PubChem CID 67483789) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methanehydrazonoylnaphthalen-1-yl)oxyethanone.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methanehydrazonoylnaphthalen-1-yl)oxyethanone |
|---|---|
| PubChem CID | 67483789 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methanehydrazonoylnaphthalen-1-yl)oxyethanone |
| SMILES | NN=Cc1ccc(OCC(=O)N2CCc3ccccc3C2)c2ccccc12 |
| InChI | InChI=1S/C22H21N3O2/c23-24-13-17-9-10-21(20-8-4-3-7-19(17)20)27-15-22(26)25-12-11-16-5-1-2-6-18(16)14-25/h1-10,13H,11-12,14-15,23H2 |
| InChIKey | FDXCQDMSDJAKKQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|