C16H15F3N2O2 — CID 674855
(Z)-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 674855) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is (Z)-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 674855 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (Z)-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cccc(C(F)(F)F)c1)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H15F3N2O2/c17-16(18,19)13-4-1-3-11(8-13)7-12(9-20)15(22)21-10-14-5-2-6-23-14/h1,3-4,7-8,14H,2,5-6,10H2,(H,21,22)/b12-7-/t14-/m1/s1 |
| InChIKey | RMFHJEFYUHZBKF-YRBHFNIASA-N |
| XLogP | 2.91 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|