C21H23IO4 — CID 67486425
methyl 4-[(2S)-1-iodo-3-phenylpropan-2-yl]oxy-2,2-dimethyl-3H-1-benzofuran-6-carboxylate (PubChem CID 67486425) has the molecular formula C21H23IO4 and a molecular weight of 466.32 g/mol. Its IUPAC name is methyl 4-[(2S)-1-iodo-3-phenylpropan-2-yl]oxy-2,2-dimethyl-3H-1-benzofuran-6-carboxylate.
| Compound Name | methyl 4-[(2S)-1-iodo-3-phenylpropan-2-yl]oxy-2,2-dimethyl-3H-1-benzofuran-6-carboxylate |
|---|---|
| PubChem CID | 67486425 |
| Molecular Formula | C21H23IO4 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | methyl 4-[(2S)-1-iodo-3-phenylpropan-2-yl]oxy-2,2-dimethyl-3H-1-benzofuran-6-carboxylate |
| SMILES | COC(=O)c1cc(O[C@H](CI)Cc2ccccc2)c2c(c1)OC(C)(C)C2 |
| InChI | InChI=1S/C21H23IO4/c1-21(2)12-17-18(10-15(20(23)24-3)11-19(17)26-21)25-16(13-22)9-14-7-5-4-6-8-14/h4-8,10-11,16H,9,12-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | WFMHNIHQMSQXLN-INIZCTEOSA-N |
| XLogP | 4.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|