C21H21F3N4O — CID 67487509
N-[2-(dimethylamino)ethyl]-3-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]prop-2-enamide (PubChem CID 67487509) has the molecular formula C21H21F3N4O and a molecular weight of 402.42 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]prop-2-enamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67487509 |
| Molecular Formula | C21H21F3N4O |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]prop-2-enamide |
| SMILES | CN(C)CCNC(=O)C=Cc1cc(C(F)(F)F)cc2ncn(-c3ccccc3)c12 |
| InChI | InChI=1S/C21H21F3N4O/c1-27(2)11-10-25-19(29)9-8-15-12-16(21(22,23)24)13-18-20(15)28(14-26-18)17-6-4-3-5-7-17/h3-9,12-14H,10-11H2,1-2H3,(H,25,29) |
| InChIKey | FSMXJVSOCLECIS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|