C21H20F3N3O — CID 11383636
(Z)-N,N-diethyl-3-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]prop-2-enamide (PubChem CID 11383636) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is (Z)-N,N-diethyl-3-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]prop-2-enamide.
| Compound Name | (Z)-N,N-diethyl-3-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11383636 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (Z)-N,N-diethyl-3-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]prop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C\c1cc(C(F)(F)F)cc2ncn(-c3ccccc3)c12 |
| InChI | InChI=1S/C21H20F3N3O/c1-3-26(4-2)19(28)11-10-15-12-16(21(22,23)24)13-18-20(15)27(14-25-18)17-8-6-5-7-9-17/h5-14H,3-4H2,1-2H3/b11-10- |
| InChIKey | YJBDUOGFLWIRMY-KHPPLWFESA-N |
| XLogP | 4.93 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|