C24H28N2O5PS+ — CID 67490617
ethoxy-oxo-[[6-[[3-propan-2-yloxy-5-(2-thiophen-3-ylethoxy)benzoyl]amino]-3-pyridinyl]methyl]phosphanium (PubChem CID 67490617) has the molecular formula C24H28N2O5PS+ and a molecular weight of 487.54 g/mol. Its IUPAC name is ethoxy-oxo-[[6-[[3-propan-2-yloxy-5-(2-thiophen-3-ylethoxy)benzoyl]amino]-3-pyridinyl]methyl]phosphanium.
| Compound Name | ethoxy-oxo-[[6-[[3-propan-2-yloxy-5-(2-thiophen-3-ylethoxy)benzoyl]amino]-3-pyridinyl]methyl]phosphanium |
|---|---|
| PubChem CID | 67490617 |
| Molecular Formula | C24H28N2O5PS+ |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | ethoxy-oxo-[[6-[[3-propan-2-yloxy-5-(2-thiophen-3-ylethoxy)benzoyl]amino]-3-pyridinyl]methyl]phosphanium |
| SMILES | CCO[P+](=O)Cc1ccc(NC(=O)c2cc(OCCc3ccsc3)cc(OC(C)C)c2)nc1 |
| InChI | InChI=1S/C24H27N2O5PS/c1-4-30-32(28)15-19-5-6-23(25-14-19)26-24(27)20-11-21(13-22(12-20)31-17(2)3)29-9-7-18-8-10-33-16-18/h5-6,8,10-14,16-17H,4,7,9,15H2,1-3H3/p+1 |
| InChIKey | IYICZBHALSWEQM-UHFFFAOYSA-O |
| XLogP | 6.08 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|