C21H30N2O3 — CID 67491446
tert-butyl N-[(3aS,7aS)-6-oxo-2-[(1R)-1-phenylethyl]-1,3,4,5,7,7a-hexahydroisoindol-3a-yl]carbamate (PubChem CID 67491446) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl N-[(3aS,7aS)-6-oxo-2-[(1R)-1-phenylethyl]-1,3,4,5,7,7a-hexahydroisoindol-3a-yl]carbamate.
| Compound Name | tert-butyl N-[(3aS,7aS)-6-oxo-2-[(1R)-1-phenylethyl]-1,3,4,5,7,7a-hexahydroisoindol-3a-yl]carbamate |
|---|---|
| PubChem CID | 67491446 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | tert-butyl N-[(3aS,7aS)-6-oxo-2-[(1R)-1-phenylethyl]-1,3,4,5,7,7a-hexahydroisoindol-3a-yl]carbamate |
| SMILES | C[C@H](c1ccccc1)N1C[C@@H]2CC(=O)CC[C@@]2(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H30N2O3/c1-15(16-8-6-5-7-9-16)23-13-17-12-18(24)10-11-21(17,14-23)22-19(25)26-20(2,3)4/h5-9,15,17H,10-14H2,1-4H3,(H,22,25)/t15-,17+,21-/m1/s1 |
| InChIKey | CRVYZPOYQOTKRV-LDBYXDLTSA-N |
| XLogP | 3.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |