C20H30N2O3 — CID 147841196
tert-butyl N-[(7aS)-2-[(1R)-1-phenylethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]carbamate (PubChem CID 147841196) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is tert-butyl N-[(7aS)-2-[(1R)-1-phenylethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]carbamate.
| Compound Name | tert-butyl N-[(7aS)-2-[(1R)-1-phenylethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]carbamate |
|---|---|
| PubChem CID | 147841196 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl N-[(7aS)-2-[(1R)-1-phenylethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]carbamate |
| SMILES | C[C@H](c1ccccc1)N1CC2COCC[C@@]2(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H30N2O3/c1-15(16-8-6-5-7-9-16)22-12-17-13-24-11-10-20(17,14-22)21-18(23)25-19(2,3)4/h5-9,15,17H,10-14H2,1-4H3,(H,21,23)/t15-,17?,20-/m1/s1 |
| InChIKey | HSZVLFMFZYSSHR-QMBUQHDCSA-N |
| XLogP | 3.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |