C24H30N6O3S — CID 67491980
4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-N-[(1S,3R)-3-(3-cyclopropyl-1,2,4-triazol-4-yl)cyclohexyl]-2-ethylbenzenesulfonamide (PubChem CID 67491980) has the molecular formula C24H30N6O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-N-[(1S,3R)-3-(3-cyclopropyl-1,2,4-triazol-4-yl)cyclohexyl]-2-ethylbenzenesulfonamide.
| Compound Name | 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-N-[(1S,3R)-3-(3-cyclopropyl-1,2,4-triazol-4-yl)cyclohexyl]-2-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 67491980 |
| Molecular Formula | C24H30N6O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-N-[(1S,3R)-3-(3-cyclopropyl-1,2,4-triazol-4-yl)cyclohexyl]-2-ethylbenzenesulfonamide |
| SMILES | CCc1cc(-c2noc(C3CC3)n2)ccc1S(=O)(=O)N[C@H]1CCC[C@@H](n2cnnc2C2CC2)C1 |
| InChI | InChI=1S/C24H30N6O3S/c1-2-15-12-18(22-26-24(33-28-22)17-8-9-17)10-11-21(15)34(31,32)29-19-4-3-5-20(13-19)30-14-25-27-23(30)16-6-7-16/h10-12,14,16-17,19-20,29H,2-9,13H2,1H3/t19-,20+/m0/s1 |
| InChIKey | QONYKAMMSWKABF-VQTJNVASSA-N |
| XLogP | 4.11 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |