C17H11BrFNO3 — CID 67492733
3-(bromomethyl)-2-(2-fluorophenyl)-1-oxoisoquinoline-4-carboxylic acid (PubChem CID 67492733) has the molecular formula C17H11BrFNO3 and a molecular weight of 376.18 g/mol. Its IUPAC name is 3-(bromomethyl)-2-(2-fluorophenyl)-1-oxoisoquinoline-4-carboxylic acid.
| Compound Name | 3-(bromomethyl)-2-(2-fluorophenyl)-1-oxoisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 67492733 |
| Molecular Formula | C17H11BrFNO3 |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 3-(bromomethyl)-2-(2-fluorophenyl)-1-oxoisoquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1c(CBr)n(-c2ccccc2F)c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H11BrFNO3/c18-9-14-15(17(22)23)10-5-1-2-6-11(10)16(21)20(14)13-8-4-3-7-12(13)19/h1-8H,9H2,(H,22,23) |
| InChIKey | IWKJLOFBKDGHHC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|