C22H25ClN6O2S — CID 67495342
2-[(3S)-3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-chlorophenyl]sulfonylpyrrolidin-1-yl]pyrimidine-4-carbonitrile (PubChem CID 67495342) has the molecular formula C22H25ClN6O2S and a molecular weight of 473.00 g/mol. Its IUPAC name is 2-[(3S)-3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-chlorophenyl]sulfonylpyrrolidin-1-yl]pyrimidine-4-carbonitrile.
| Compound Name | 2-[(3S)-3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-chlorophenyl]sulfonylpyrrolidin-1-yl]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 67495342 |
| Molecular Formula | C22H25ClN6O2S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-[(3S)-3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-chlorophenyl]sulfonylpyrrolidin-1-yl]pyrimidine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CC[C@H](S(=O)(=O)c3ccc(N4CCN5CCCC5C4)cc3Cl)C2)n1 |
| InChI | InChI=1S/C22H25ClN6O2S/c23-20-12-17(28-11-10-27-8-1-2-18(27)14-28)3-4-21(20)32(30,31)19-6-9-29(15-19)22-25-7-5-16(13-24)26-22/h3-5,7,12,18-19H,1-2,6,8-11,14-15H2/t18?,19-/m0/s1 |
| InChIKey | WLCXRSOUPQCAGF-GGYWPGCISA-N |
| XLogP | 2.34 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |