C14H13ClFN3O2S — CID 141328638
2-[(3S)-3-(2-chloro-4-fluorophenyl)sulfonylpyrrolidin-1-yl]pyrimidine (PubChem CID 141328638) has the molecular formula C14H13ClFN3O2S and a molecular weight of 341.80 g/mol. Its IUPAC name is 2-[(3S)-3-(2-chloro-4-fluorophenyl)sulfonylpyrrolidin-1-yl]pyrimidine.
| Compound Name | 2-[(3S)-3-(2-chloro-4-fluorophenyl)sulfonylpyrrolidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 141328638 |
| Molecular Formula | C14H13ClFN3O2S |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-[(3S)-3-(2-chloro-4-fluorophenyl)sulfonylpyrrolidin-1-yl]pyrimidine |
| SMILES | O=S(=O)(c1ccc(F)cc1Cl)[C@H]1CCN(c2ncccn2)C1 |
| InChI | InChI=1S/C14H13ClFN3O2S/c15-12-8-10(16)2-3-13(12)22(20,21)11-4-7-19(9-11)14-17-5-1-6-18-14/h1-3,5-6,8,11H,4,7,9H2/t11-/m0/s1 |
| InChIKey | UUHUPBSPSNQGIU-NSHDSACASA-N |
| XLogP | 2.32 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |