C15H14ClFN2O2S — CID 136539939
2-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-3-yl]pyridine (PubChem CID 136539939) has the molecular formula C15H14ClFN2O2S and a molecular weight of 340.81 g/mol. Its IUPAC name is 2-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-3-yl]pyridine.
| Compound Name | 2-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-3-yl]pyridine |
|---|---|
| PubChem CID | 136539939 |
| Molecular Formula | C15H14ClFN2O2S |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-3-yl]pyridine |
| SMILES | O=S(=O)(c1cc(F)ccc1Cl)N1CCC(c2ccccn2)C1 |
| InChI | InChI=1S/C15H14ClFN2O2S/c16-13-5-4-12(17)9-15(13)22(20,21)19-8-6-11(10-19)14-3-1-2-7-18-14/h1-5,7,9,11H,6,8,10H2 |
| InChIKey | RPVQQPRFWBYNGH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |