C23H22ClFN2O2S — CID 124975359
2-[(3R)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]-5-[(3-fluorophenyl)methyl]pyridine (PubChem CID 124975359) has the molecular formula C23H22ClFN2O2S and a molecular weight of 444.96 g/mol. Its IUPAC name is 2-[(3R)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]-5-[(3-fluorophenyl)methyl]pyridine.
| Compound Name | 2-[(3R)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]-5-[(3-fluorophenyl)methyl]pyridine |
|---|---|
| PubChem CID | 124975359 |
| Molecular Formula | C23H22ClFN2O2S |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-[(3R)-1-(2-chlorophenyl)sulfonylpiperidin-3-yl]-5-[(3-fluorophenyl)methyl]pyridine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCC[C@@H](c2ccc(Cc3cccc(F)c3)cn2)C1 |
| InChI | InChI=1S/C23H22ClFN2O2S/c24-21-8-1-2-9-23(21)30(28,29)27-12-4-6-19(16-27)22-11-10-18(15-26-22)13-17-5-3-7-20(25)14-17/h1-3,5,7-11,14-15,19H,4,6,12-13,16H2/t19-/m1/s1 |
| InChIKey | KXIYUPYJRNAVAB-LJQANCHMSA-N |
| XLogP | 5.03 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |