C38H50N2O8S — CID 67495626
(3S,4S,5R)-4-[4-[1-(cyclopropylmethoxy)-2-methoxyethyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-ol (PubChem CID 67495626) has the molecular formula C38H50N2O8S and a molecular weight of 694.89 g/mol. Its IUPAC name is (3S,4S,5R)-4-[4-[1-(cyclopropylmethoxy)-2-methoxyethyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-ol.
| Compound Name | (3S,4S,5R)-4-[4-[1-(cyclopropylmethoxy)-2-methoxyethyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 67495626 |
| Molecular Formula | C38H50N2O8S |
| Molecular Weight | 694.89 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | (3S,4S,5R)-4-[4-[1-(cyclopropylmethoxy)-2-methoxyethyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-ol |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(S(=O)(=O)c4ccc(C)cc4)C[C@@H](O)[C@@H]3c3ccc(C(COC)OCC4CC4)cc3)cc21 |
| InChI | InChI=1S/C38H50N2O8S/c1-27-5-14-32(15-6-27)49(42,43)40-22-34(41)38(31-12-10-30(11-13-31)37(26-45-3)48-24-28-7-8-28)36(23-40)47-25-29-9-16-35-33(21-29)39(18-20-46-35)17-4-19-44-2/h5-6,9-16,21,28,34,36-38,41H,4,7-8,17-20,22-26H2,1-3H3/t34-,36+,37?,38+/m1/s1 |
| InChIKey | LPCJSFHICDQZEA-UXKTVZTNSA-N |
| XLogP | 5.08 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.89 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|