C16H14FN5O3 — CID 67498031
methyl 5-[[3-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]pyrazine-2-carboxylate (PubChem CID 67498031) has the molecular formula C16H14FN5O3 and a molecular weight of 343.32 g/mol. Its IUPAC name is methyl 5-[[3-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[[3-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 67498031 |
| Molecular Formula | C16H14FN5O3 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | methyl 5-[[3-(4-fluorophenyl)-5-methyltriazol-4-yl]methoxy]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(OCc2c(C)nnn2-c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C16H14FN5O3/c1-10-14(22(21-20-10)12-5-3-11(17)4-6-12)9-25-15-8-18-13(7-19-15)16(23)24-2/h3-8H,9H2,1-2H3 |
| InChIKey | PQAXPGCNSRJFHK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |