C14H11FIN5O — CID 167438741
3-fluoro-6-[[3-(4-iodophenyl)-5-methyltriazol-4-yl]methoxy]pyridazine (PubChem CID 167438741) has the molecular formula C14H11FIN5O and a molecular weight of 411.18 g/mol. Its IUPAC name is 3-fluoro-6-[[3-(4-iodophenyl)-5-methyltriazol-4-yl]methoxy]pyridazine.
| Compound Name | 3-fluoro-6-[[3-(4-iodophenyl)-5-methyltriazol-4-yl]methoxy]pyridazine |
|---|---|
| PubChem CID | 167438741 |
| Molecular Formula | C14H11FIN5O |
| Molecular Weight | 411.18 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 3-fluoro-6-[[3-(4-iodophenyl)-5-methyltriazol-4-yl]methoxy]pyridazine |
| SMILES | Cc1nnn(-c2ccc(I)cc2)c1COc1ccc(F)nn1 |
| InChI | InChI=1S/C14H11FIN5O/c1-9-12(8-22-14-7-6-13(15)18-19-14)21(20-17-9)11-4-2-10(16)3-5-11/h2-7H,8H2,1H3 |
| InChIKey | HREXARFSFUFPFQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|