C19H19F2N5O — CID 175395875
5-(azetidin-1-yl)-2-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridine (PubChem CID 175395875) has the molecular formula C19H19F2N5O and a molecular weight of 371.39 g/mol. Its IUPAC name is 5-(azetidin-1-yl)-2-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridine.
| Compound Name | 5-(azetidin-1-yl)-2-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 175395875 |
| Molecular Formula | C19H19F2N5O |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 5-(azetidin-1-yl)-2-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridine |
| SMILES | Cc1nnn(-c2ccc(C(F)F)cc2)c1COc1ccc(N2CCC2)cn1 |
| InChI | InChI=1S/C19H19F2N5O/c1-13-17(12-27-18-8-7-16(11-22-18)25-9-2-10-25)26(24-23-13)15-5-3-14(4-6-15)19(20)21/h3-8,11,19H,2,9-10,12H2,1H3 |
| InChIKey | NCXQAWUSONBELR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |