C23H27ClN2O2 — CID 67498795
N-(4-tert-butylphenyl)-4-(3-chloro-2-pyridinyl)-4-methoxycyclohexene-1-carboxamide (PubChem CID 67498795) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-(3-chloro-2-pyridinyl)-4-methoxycyclohexene-1-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-4-(3-chloro-2-pyridinyl)-4-methoxycyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 67498795 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-(3-chloro-2-pyridinyl)-4-methoxycyclohexene-1-carboxamide |
| SMILES | COC1(c2ncccc2Cl)CC=C(C(=O)Nc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H27ClN2O2/c1-22(2,3)17-7-9-18(10-8-17)26-21(27)16-11-13-23(28-4,14-12-16)20-19(24)6-5-15-25-20/h5-11,15H,12-14H2,1-4H3,(H,26,27) |
| InChIKey | OAEHPCJAZQRSEC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |