C20H18F4N2O — CID 42600843
4-fluoro-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]cyclohexene-1-carboxamide (PubChem CID 42600843) has the molecular formula C20H18F4N2O and a molecular weight of 378.37 g/mol. Its IUPAC name is 4-fluoro-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]cyclohexene-1-carboxamide.
| Compound Name | 4-fluoro-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 42600843 |
| Molecular Formula | C20H18F4N2O |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-fluoro-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]cyclohexene-1-carboxamide |
| SMILES | Cc1cccnc1C1(F)CC=C(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H18F4N2O/c1-13-3-2-12-25-17(13)19(21)10-8-14(9-11-19)18(27)26-16-6-4-15(5-7-16)20(22,23)24/h2-8,12H,9-11H2,1H3,(H,26,27) |
| InChIKey | ODBRHZFYFBORIC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |