C31H35F4N5O — CID 57336000
4-fluoro-N'-[1-(3-methoxyphenyl)piperidin-4-yl]-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboximidamide (PubChem CID 57336000) has the molecular formula C31H35F4N5O and a molecular weight of 569.65 g/mol. Its IUPAC name is 4-fluoro-N'-[1-(3-methoxyphenyl)piperidin-4-yl]-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboximidamide.
| Compound Name | 4-fluoro-N'-[1-(3-methoxyphenyl)piperidin-4-yl]-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 57336000 |
| Molecular Formula | C31H35F4N5O |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | 4-fluoro-N'-[1-(3-methoxyphenyl)piperidin-4-yl]-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboximidamide |
| SMILES | COc1cccc(N2CCC(/N=C(/Nc3ccc(C(F)(F)F)cc3)N3CCC(F)(c4ncccc4C)CC3)CC2)c1 |
| InChI | InChI=1S/C31H35F4N5O/c1-22-5-4-16-36-28(22)30(32)14-19-40(20-15-30)29(37-24-10-8-23(9-11-24)31(33,34)35)38-25-12-17-39(18-13-25)26-6-3-7-27(21-26)41-2/h3-11,16,21,25H,12-15,17-20H2,1-2H3,(H,37,38) |
| InChIKey | FLVKNMTXVWGMLD-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|