C19H19F4N3O — CID 11349537
4-fluoro-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 11349537) has the molecular formula C19H19F4N3O and a molecular weight of 381.37 g/mol. Its IUPAC name is 4-fluoro-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-fluoro-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 11349537 |
| Molecular Formula | C19H19F4N3O |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 4-fluoro-4-(3-methyl-2-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | Cc1cccnc1C1(F)CCN(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H19F4N3O/c1-13-3-2-10-24-16(13)18(20)8-11-26(12-9-18)17(27)25-15-6-4-14(5-7-15)19(21,22)23/h2-7,10H,8-9,11-12H2,1H3,(H,25,27) |
| InChIKey | YUPDDSXQVRZKGH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |