C31H37FN4O2 — CID 87885440
4-fluoro-4-(3-methyl-2-pyridinyl)-N-(4-propan-2-ylphenyl)piperidine-1-carboxamide;1-isocyanato-4-propan-2-ylbenzene (PubChem CID 87885440) has the molecular formula C31H37FN4O2 and a molecular weight of 516.66 g/mol. Its IUPAC name is 4-fluoro-4-(3-methyl-2-pyridinyl)-N-(4-propan-2-ylphenyl)piperidine-1-carboxamide;1-isocyanato-4-propan-2-ylbenzene.
| Compound Name | 4-fluoro-4-(3-methyl-2-pyridinyl)-N-(4-propan-2-ylphenyl)piperidine-1-carboxamide;1-isocyanato-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 87885440 |
| Molecular Formula | C31H37FN4O2 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 4-fluoro-4-(3-methyl-2-pyridinyl)-N-(4-propan-2-ylphenyl)piperidine-1-carboxamide;1-isocyanato-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(N=C=O)cc1.Cc1cccnc1C1(F)CCN(C(=O)Nc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H26FN3O.C10H11NO/c1-15(2)17-6-8-18(9-7-17)24-20(26)25-13-10-21(22,11-14-25)19-16(3)5-4-12-23-19;1-8(2)9-3-5-10(6-4-9)11-7-12/h4-9,12,15H,10-11,13-14H2,1-3H3,(H,24,26);3-6,8H,1-2H3 |
| InChIKey | AUYYAMGXLSCOLL-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|