C19H19ClF2N4OS — CID 136592617
methyl N-[4-(3-chloro-2-pyridinyl)-4-fluoropiperidine-1-carbonyl]-N'-(4-fluorophenyl)carbamimidothioate (PubChem CID 136592617) has the molecular formula C19H19ClF2N4OS and a molecular weight of 424.90 g/mol. Its IUPAC name is methyl N-[4-(3-chloro-2-pyridinyl)-4-fluoropiperidine-1-carbonyl]-N'-(4-fluorophenyl)carbamimidothioate.
| Compound Name | methyl N-[4-(3-chloro-2-pyridinyl)-4-fluoropiperidine-1-carbonyl]-N'-(4-fluorophenyl)carbamimidothioate |
|---|---|
| PubChem CID | 136592617 |
| Molecular Formula | C19H19ClF2N4OS |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | methyl N-[4-(3-chloro-2-pyridinyl)-4-fluoropiperidine-1-carbonyl]-N'-(4-fluorophenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(F)cc1)NC(=O)N1CCC(F)(c2ncccc2Cl)CC1 |
| InChI | InChI=1S/C19H19ClF2N4OS/c1-28-17(24-14-6-4-13(21)5-7-14)25-18(27)26-11-8-19(22,9-12-26)16-15(20)3-2-10-23-16/h2-7,10H,8-9,11-12H2,1H3,(H,24,25,27) |
| InChIKey | DILKVMQQYISREI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|