C11H24ClN — CID 67499147
(2S,6R)-2-methyl-6-(3-methylbutyl)piperidine;hydrochloride (PubChem CID 67499147) has the molecular formula C11H24ClN and a molecular weight of 205.77 g/mol. Its IUPAC name is (2S,6R)-2-methyl-6-(3-methylbutyl)piperidine;hydrochloride.
| Compound Name | (2S,6R)-2-methyl-6-(3-methylbutyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 67499147 |
| Molecular Formula | C11H24ClN |
| Molecular Weight | 205.77 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (2S,6R)-2-methyl-6-(3-methylbutyl)piperidine;hydrochloride |
| SMILES | CC(C)CC[C@H]1CCC[C@H](C)N1.Cl |
| InChI | InChI=1S/C11H23N.ClH/c1-9(2)7-8-11-6-4-5-10(3)12-11;/h9-12H,4-8H2,1-3H3;1H/t10-,11+;/m0./s1 |
| InChIKey | NYCZUZQLHCRIFV-VZXYPILPSA-N |
| XLogP | 3.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |